cas: 1210-34-0 — see every product listed under this CAS number, including other names
DIBENZOSUBEROL, 98%, 98% (CAS 1210-34-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 1mg, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114PBM-100mg |
| cas | 1210-34-0 |
| size | 100mg |
| availability | 116g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 198.80 Pln | |
| Chemat | 10g | 266.00 Pln | |
| Chemat | 1mg | 78.80 Pln | |
| Chemat | 25g | 573.20 Pln | |
| Chemat | 100g | 1979.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-2-ol (CAS 1210-34-0) is a chemical compound with the molecular formula C15H14O and a molecular weight of 210.27 g/mol. IUPAC name: tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-2-ol. InChIKey: POAVRNPUPPJLKZ-UHFFFAOYSA-N.
| Molecular formula | C15H14O |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-2-ol |
| InChIKey | POAVRNPUPPJLKZ-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2C(C3=CC=CC=C31)O |
Computed by PubChem (NCBI)