cas: 7686-78-4 — see every product listed under this CAS number, including other names
DIETHYL 2-VINYLCYCLOPROPANE-1,1-DICARBOXYLATE, 97% (CAS 7686-78-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F470918-100MG |
| cas | 7686-78-4 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 112.48 Pln | |
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 5g | 1549.47 Pln | |
| Fluorochem | 25g | 2049.30 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 793.12 Pln | |
| Ambeed | 5g | 2845.69 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Diethyl 2-ethenylcyclopropane-1,1-dicarboxylate (CAS 7686-78-4) is a chemical compound with the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. IUPAC name: diethyl 2-ethenylcyclopropane-1,1-dicarboxylate. InChIKey: UOQTXZICFVMERR-UHFFFAOYSA-N.
| Molecular formula | C11H16O4 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | diethyl 2-ethenylcyclopropane-1,1-dicarboxylate |
| InChIKey | UOQTXZICFVMERR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC1C=C)C(=O)OCC |
Computed by PubChem (NCBI)