CAS 7686-78-4 appears in our catalog under these names: Diethyl 2–vinylcyclopropane–1,1–dicarboxylate, 2-Vinylcyclopropane-1,1-dicarboxylic acid diethyl ester, Diethyl 2-vinylcyclopropane-1,1-dicarboxylate, 97%, 97%, DIETHYL 2-VINYLCYCLOPROPANE-1,1-DICARBOXYLATE, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g.
Diethyl 2-ethenylcyclopropane-1,1-dicarboxylate (CAS 7686-78-4) is a chemical compound with the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. IUPAC name: diethyl 2-ethenylcyclopropane-1,1-dicarboxylate. InChIKey: UOQTXZICFVMERR-UHFFFAOYSA-N.
| Molecular formula | C11H16O4 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | diethyl 2-ethenylcyclopropane-1,1-dicarboxylate |
| InChIKey | UOQTXZICFVMERR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC1C=C)C(=O)OCC |
Computed by PubChem (NCBI)