cas: 113411-17-9 — see every product listed under this CAS number, including other names
DIF-3 (CAS 113411-17-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg. Offered by: TargetMol, Chemat.
| brand | TargetMol |
|---|---|
| catalog number | T60485-1mg |
| cas | 113411-17-9 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 784.16 Pln | |
| TargetMol | 5mg | 1754.02 Pln | |
| TargetMol | 10mg | 2524.32 Pln | |
| TargetMol | 25mg | 4104.62 Pln | |
| TargetMol | 50mg | 5764.85 Pln | |
| TargetMol | 100mg | 7704.02 Pln | |
| TargetMol | 500mg | 15527.22 Pln | |
| Chemat | 1mg | 621.20 Pln | |
| Chemat | 5mg | 1720.40 Pln | |
| Chemat | 10mg | 2522.00 Pln | |
| Chemat | 25mg | 4000.40 Pln | |
| Chemat | 50mg | 5392.40 Pln | |
| Chemat | 100mg | 6856.40 Pln |
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
1-(3-chloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one (CAS 113411-17-9) is a chemical compound with the molecular formula C13H17ClO4 and a molecular weight of 272.72 g/mol. IUPAC name: 1-(3-chloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one. InChIKey: JWBMZIJMSBFBIY-UHFFFAOYSA-N.
| Molecular formula | C13H17ClO4 |
|---|---|
| Molecular weight | 272.72 g/mol |
| IUPAC name | 1-(3-chloro-2,6-dihydroxy-4-methoxyphenyl)hexan-1-one |
| InChIKey | JWBMZIJMSBFBIY-UHFFFAOYSA-N |
| SMILES | CCCCCC(=O)C1=C(C(=C(C=C1O)OC)Cl)O |
Computed by PubChem (NCBI)