cas: 19538-71-7 — see every product listed under this CAS number, including other names
DL-Benzylmercapturic acid, 96%, 96% (CAS 19538-71-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114SP0-100mg |
| cas | 19538-71-7 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 568.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-acetamido-3-benzylsulfanylpropanoic acid (CAS 19538-71-7) is a chemical compound with the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. IUPAC name: 2-acetamido-3-benzylsulfanylpropanoic acid. InChIKey: BJUXDERNWYKSIQ-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | 2-acetamido-3-benzylsulfanylpropanoic acid |
| InChIKey | BJUXDERNWYKSIQ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CSCC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)