CAS 201404-15-1 appears in our catalog under these names: N-(Acetyl-d3)-S-benzyl-L-cysteine, >95% (HPLC), (2R)–3–benzylsulfanyl–2–((2,2,2–trideuterioacetyl)amino)propanoic acid, N-(Acetyl-d3)-S-benzyl-L-cysteine. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 50mg, 1 mg.
(2R)-3-benzylsulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid (CAS 201404-15-1) is a chemical compound with the molecular formula C12H15NO3S and a molecular weight of 256.34 g/mol. IUPAC name: (2R)-3-benzylsulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid. InChIKey: BJUXDERNWYKSIQ-DCLJDFQTSA-N.
| Molecular formula | C12H15NO3S |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | (2R)-3-benzylsulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid |
| InChIKey | BJUXDERNWYKSIQ-DCLJDFQTSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)N[C@@H](CSCC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)