CAS 10290-61-6 appears in our catalog under these names: Bz-met-oh, 95%, Bz–Met–OH, Bz-L-Met-OH, Bz-Met-OH 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed. Available pack sizes: 25g, 100g, 1g, 5g.
(2S)-2-benzamido-4-methylsulfanylbutanoic acid (CAS 10290-61-6) is a chemical compound with the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. IUPAC name: (2S)-2-benzamido-4-methylsulfanylbutanoic acid. InChIKey: PPFRJEXUPZWQPI-JTQLQIEISA-N.
| Molecular formula | C12H15NO3S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | (2S)-2-benzamido-4-methylsulfanylbutanoic acid |
| InChIKey | PPFRJEXUPZWQPI-JTQLQIEISA-N |
| SMILES | CSCC[C@@H](C(=O)O)NC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)