DMCM hydrochloride
cas: 1215833-62-7 — see every product listed under this CAS number, including other names
DMCM hydrochloride (CAS 1215833-62-7) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 1mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC13405-10 |
| cas | 1215833-62-7 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 1032.33 Pln | |
| GLPBio | 100mg | 4584.83 Pln | |
| GLPBio | 25mg | 1804.61 Pln | |
| GLPBio | 5mg | 835.75 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 966.80 Pln | |
| GLPBio | 50mg | 3058.98 Pln | |
| Chemat | 1mg | 232.40 Pln | |
| Chemat | 5mg | 510.80 Pln | |
| Chemat | 10mg | 736.40 Pln | |
| Chemat | 25mg | 1590.80 Pln | |
| Chemat | 50mg | 2277.20 Pln | |
| Chemat | 100mg | 3352.40 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 4-ethyl-6,7-dimethoxy-9H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride (CAS 1215833-62-7) is a chemical compound with the molecular formula C17H19ClN2O4 and a molecular weight of 350.8 g/mol. IUPAC name: methyl 4-ethyl-6,7-dimethoxy-9H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride. InChIKey: FHCRBVQGMZUJKY-UHFFFAOYSA-N.
| Molecular formula | C17H19ClN2O4 |
|---|---|
| Molecular weight | 350.8 g/mol |
| IUPAC name | methyl 4-ethyl-6,7-dimethoxy-9H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride |
| InChIKey | FHCRBVQGMZUJKY-UHFFFAOYSA-N |
| SMILES | CCC1=C2C3=CC(=C(C=C3NC2=CN=C1C(=O)OC)OC)OC.Cl |
Computed by PubChem (NCBI)