CAS 1226855-28-2 appears in our catalog under these names: DSP-0565/ 97.62% (existing batch purity), DSP–0565, DSP-0565. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
2-[2-(2-fluorophenyl)phenyl]acetamide (CAS 1226855-28-2) is a chemical compound with the molecular formula C14H12FNO and a molecular weight of 229.25 g/mol. IUPAC name: 2-[2-(2-fluorophenyl)phenyl]acetamide. InChIKey: MWAPNZXZUGCADE-UHFFFAOYSA-N.
| Molecular formula | C14H12FNO |
|---|---|
| Molecular weight | 229.25 g/mol |
| IUPAC name | 2-[2-(2-fluorophenyl)phenyl]acetamide |
| InChIKey | MWAPNZXZUGCADE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)N)C2=CC=CC=C2F |
Computed by PubChem (NCBI)