CAS 59943-31-6 appears in our catalog under these names: DU717/ 99.64% (existing batch purity), DU717, 7-Chloro-3-(4-methyl-1-piperazinyl)-4H-1,2,4-benzothiadiazine-1,1-dioxide. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 20mg, 1 mg.
7-chloro-3-(4-methylpiperazin-1-yl)-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide (CAS 59943-31-6) is a chemical compound with the molecular formula C12H15ClN4O2S and a molecular weight of 314.79 g/mol. IUPAC name: 7-chloro-3-(4-methylpiperazin-1-yl)-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide. InChIKey: JPZVJONKWYICFB-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN4O2S |
|---|---|
| Molecular weight | 314.79 g/mol |
| IUPAC name | 7-chloro-3-(4-methylpiperazin-1-yl)-4H-1lambda6,2,4-benzothiadiazine 1,1-dioxide |
| InChIKey | JPZVJONKWYICFB-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NS(=O)(=O)C3=C(N2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)