Products 139226-28-1
CAS 139226-28-1 appears in our catalog under these names: Darbufelone, Darbufelone/ 99.77% (existing batch purity), Darbufelone, 99.49%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
(5Z)-2-amino-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-thiazol-4-one (CAS 139226-28-1) is a chemical compound with the molecular formula C18H24N2O2S and a molecular weight of 332.5 g/mol. IUPAC name: (5Z)-2-amino-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-thiazol-4-one. InChIKey: AKTXOQVMWSFEBQ-LCYFTJDESA-N.
| Molecular formula | C18H24N2O2S |
|---|---|
| Molecular weight | 332.5 g/mol |
| IUPAC name | (5Z)-2-amino-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1,3-thiazol-4-one |
| InChIKey | AKTXOQVMWSFEBQ-LCYFTJDESA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)/C=C\2/C(=O)N=C(S2)N |
Computed by PubChem (NCBI)