Darglitazone
cas: 141200-24-0 — see every product listed under this CAS number, including other names
Darglitazone (CAS 141200-24-0) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg. Offered by: TargetMol, GLPBio, Biosynth, Chemat.
| brand | TargetMol |
|---|---|
| catalog number | T22708-2mg |
| cas | 141200-24-0 |
| size | 2mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 2mg | 399.00 Pln | |
| TargetMol | 5mg | 532.05 Pln | |
| TargetMol | 10mg | 751.17 Pln | |
| TargetMol | 25mg | 1122.91 Pln | |
| TargetMol | 50mg | 1588.00 Pln | |
| TargetMol | 100mg | 2252.09 Pln | |
| TargetMol | 200mg | 3148.73 Pln | |
| GLPBio | 10mg | 1172.74 Pln | |
| GLPBio | 5mg | 877.87 Pln | |
| Biosynth | 25mg | price on request | |
| Biosynth | 50mg | price on request | |
| Chemat | 1mg | 208.40 Pln | |
| Chemat | 2mg | 280.40 Pln | |
| Chemat | 5mg | 429.20 Pln | |
| Chemat | 10mg | 669.20 Pln | |
| Chemat | 25mg | 1091.60 Pln | |
| Chemat | 50mg | 1590.80 Pln | |
| Chemat | 100mg | 2238.80 Pln | |
| Chemat | 200mg | 3078.80 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
5-[[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propanoyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione (CAS 141200-24-0) is a chemical compound with the molecular formula C23H20N2O4S and a molecular weight of 420.5 g/mol. IUPAC name: 5-[[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propanoyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione. InChIKey: QQKNSPHAFATFNQ-UHFFFAOYSA-N.
| Molecular formula | C23H20N2O4S |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | 5-[[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propanoyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| InChIKey | QQKNSPHAFATFNQ-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC=CC=C2)CCC(=O)C3=CC=C(C=C3)CC4C(=O)NC(=O)S4 |
Computed by PubChem (NCBI)
Synonyms:
Darglitazone, darglitazona, darglitazonum, 5-(4-(3-(5-methyl-2-phenyl-4-oxazolyl)propionyl)benzyl)-2,4-thiazolidinedione, Darglitazone [INN], 5-(4-(3-(5-methyl-2-phenyloxazol-4-yl)propanoyl)benzyl)thiazolidine-2,4-dione, [3H]Darglitazone, 141200-24-0 (free), orb1305841, QQKNSPHAFATFNQ-UHFFFAOYSA-N