Products 2520347-03-7
CAS 2520347-03-7 is the registry number for BAY-184, 99.00%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 50 mg, 25 mg, 5 mg, 100 mg.
6-(dimethylamino)-N-(2-phenylphenyl)sulfonyl-1-benzofuran-2-carboxamide (CAS 2520347-03-7) is a chemical compound with the molecular formula C23H20N2O4S and a molecular weight of 420.5 g/mol. IUPAC name: 6-(dimethylamino)-N-(2-phenylphenyl)sulfonyl-1-benzofuran-2-carboxamide. InChIKey: ZUWIDJYXRPTMQW-UHFFFAOYSA-N.
| Molecular formula | C23H20N2O4S |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | 6-(dimethylamino)-N-(2-phenylphenyl)sulfonyl-1-benzofuran-2-carboxamide |
| InChIKey | ZUWIDJYXRPTMQW-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C=C(O2)C(=O)NS(=O)(=O)C3=CC=CC=C3C4=CC=CC=C4 |
Computed by PubChem (NCBI)