CAS 877966-22-8 is the registry number for 3-{(2-(1H-indol-3-yl)-2-phenylethyl)sulfamoyl}benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-[[2-(1H-indol-3-yl)-2-phenylethyl]sulfamoyl]benzoic acid (CAS 877966-22-8) is a chemical compound with the molecular formula C23H20N2O4S and a molecular weight of 420.5 g/mol. IUPAC name: 3-[[2-(1H-indol-3-yl)-2-phenylethyl]sulfamoyl]benzoic acid. InChIKey: SFGGWMFIHPUWJM-UHFFFAOYSA-N.
| Molecular formula | C23H20N2O4S |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | 3-[[2-(1H-indol-3-yl)-2-phenylethyl]sulfamoyl]benzoic acid |
| InChIKey | SFGGWMFIHPUWJM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CNS(=O)(=O)C2=CC=CC(=C2)C(=O)O)C3=CNC4=CC=CC=C43 |
Computed by PubChem (NCBI)