CAS 171714-84-4 appears in our catalog under these names: Darusentan/ 97.26% (existing batch purity), Darusentan 98%, Darusentan, 98%, 98%, Darusentan, 98.67%. Offered by: TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
(2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoic acid (CAS 171714-84-4) is a chemical compound with the molecular formula C22H22N2O6 and a molecular weight of 410.4 g/mol. IUPAC name: (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoic acid. InChIKey: FEJVSJIALLTFRP-LJQANCHMSA-N.
| Molecular formula | C22H22N2O6 |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | (2S)-2-(4,6-dimethoxypyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoic acid |
| InChIKey | FEJVSJIALLTFRP-LJQANCHMSA-N |
| SMILES | COC1=CC(=NC(=N1)O[C@H](C(=O)O)C(C2=CC=CC=C2)(C3=CC=CC=C3)OC)OC |
Computed by PubChem (NCBI)