cas: 1420-40-2 — see every product listed under this CAS number, including other names
Decamethonium iodide 97% (CAS 1420-40-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A447563-1g |
| cas | 1420-40-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 25g | 1093.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A447563 |
Trimethyl-[10-(trimethylazaniumyl)decyl]azanium diiodide (CAS 1420-40-2) is a chemical compound with the molecular formula C16H38I2N2 and a molecular weight of 512.30 g/mol. IUPAC name: trimethyl-[10-(trimethylazaniumyl)decyl]azanium diiodide. InChIKey: ARMLJSXXXFXSLQ-UHFFFAOYSA-L.
| Molecular formula | C16H38I2N2 |
|---|---|
| Molecular weight | 512.30 g/mol |
| IUPAC name | trimethyl-[10-(trimethylazaniumyl)decyl]azanium diiodide |
| InChIKey | ARMLJSXXXFXSLQ-UHFFFAOYSA-L |
| SMILES | C[N+](C)(C)CCCCCCCCCC[N+](C)(C)C.[I-].[I-] |
Computed by PubChem (NCBI)