cas: 1420-40-2 — see every product listed under this CAS number, including other names
N1,N1,N1,N10,N10,N10-Hexamethyldecane-1,10-diaminium iodide, 97%, 97% (CAS 1420-40-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112HIY-1g |
| cas | 1420-40-2 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 285.20 Pln | |
| Chemat | 25g | 1062.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Trimethyl-[10-(trimethylazaniumyl)decyl]azanium diiodide (CAS 1420-40-2) is a chemical compound with the molecular formula C16H38I2N2 and a molecular weight of 512.30 g/mol. IUPAC name: trimethyl-[10-(trimethylazaniumyl)decyl]azanium diiodide. InChIKey: ARMLJSXXXFXSLQ-UHFFFAOYSA-L.
| Molecular formula | C16H38I2N2 |
|---|---|
| Molecular weight | 512.30 g/mol |
| IUPAC name | trimethyl-[10-(trimethylazaniumyl)decyl]azanium diiodide |
| InChIKey | ARMLJSXXXFXSLQ-UHFFFAOYSA-L |
| SMILES | C[N+](C)(C)CCCCCCCCCC[N+](C)(C)C.[I-].[I-] |
Computed by PubChem (NCBI)