cas: 69679-30-7 — see every product listed under this CAS number, including other names
Decyl 4-hydroxybenzoate 95% (CAS 69679-30-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A268584-250mg |
| cas | 69679-30-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 670.75 Pln | |
| Ambeed | 10g | 1093.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A268584 |
Decyl 4-hydroxybenzoate (CAS 69679-30-7) is a chemical compound with the molecular formula C17H26O3 and a molecular weight of 278.4 g/mol. IUPAC name: decyl 4-hydroxybenzoate. InChIKey: GMMXJVUYXPXLPY-UHFFFAOYSA-N.
| Molecular formula | C17H26O3 |
|---|---|
| Molecular weight | 278.4 g/mol |
| IUPAC name | decyl 4-hydroxybenzoate |
| InChIKey | GMMXJVUYXPXLPY-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOC(=O)C1=CC=C(C=C1)O |
Computed by PubChem (NCBI)