Products 67909-49-3
CAS 67909-49-3 appears in our catalog under these names: Dehydroevodiamine/ 99.12% (existing batch purity), Dehydroevodiamine, Dehydroevodiamine 99%, Dehydroevodiamine, 99.93%, Dehydroevodiamine (Standard). Offered by: TargetMol, GLPBio, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 20mg, 250mg.
21-methyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1,3,5,7,9,15,17,19-octaen-14-one (CAS 67909-49-3) is a chemical compound with the molecular formula C19H15N3O and a molecular weight of 301.3 g/mol. IUPAC name: 21-methyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1,3,5,7,9,15,17,19-octaen-14-one. InChIKey: VXHNSVKJHXSKKM-UHFFFAOYSA-N.
| Molecular formula | C19H15N3O |
|---|---|
| Molecular weight | 301.3 g/mol |
| IUPAC name | 21-methyl-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1,3,5,7,9,15,17,19-octaen-14-one |
| InChIKey | VXHNSVKJHXSKKM-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=O)N3C1=C4C(=C5C=CC=CC5=N4)CC3 |
Computed by PubChem (NCBI)