Products 25887-71-2
CAS 25887-71-2 appears in our catalog under these names: Desmethylnortriptyline Hydrochloride, Desmethylnortriptyline Hydrochloride 1.0 mg/ml in Methanol (as free base). Offered by: LoGiCal, Biosynth. Available pack sizes: 10mg, 1ml, 0,05g, 0,025g, 0,1g, 0,25g, 0,5g.
3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propylazanium chloride (CAS 25887-71-2) is a chemical compound with the molecular formula C18H20ClN and a molecular weight of 285.8 g/mol. IUPAC name: 3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propylazanium chloride. InChIKey: ZNWIJGWRFQGTGJ-UHFFFAOYSA-N.
| Molecular formula | C18H20ClN |
|---|---|
| Molecular weight | 285.8 g/mol |
| IUPAC name | 3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propylazanium chloride |
| InChIKey | ZNWIJGWRFQGTGJ-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2C(=CCC[NH3+])C3=CC=CC=C31.[Cl-] |
Computed by PubChem (NCBI)