Products 524713-56-2
CAS 524713-56-2 appears in our catalog under these names: Dextromethorphan-d3, >95% (HPLC), Dextromethorphan-D3, Dextromethorphan-D3 0.1 mg/ml in Methanol, Dextromethorphan-D3, 0.1mg/ml in Methanol, Dextromethorphan-D3, 1mg/ml in Methanol. Offered by: TRC, Lipomed, LoGiCal, GLPBio. Available pack sizes: 50mg, 5mg, 100mg, 10mg, 1ml, 1x1ml, 1mg.
4-methoxy-17-(trideuteriomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (CAS 524713-56-2) is a chemical compound with the molecular formula C18H25NO and a molecular weight of 274.4 g/mol. IUPAC name: 4-methoxy-17-(trideuteriomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene. InChIKey: MKXZASYAUGDDCJ-FIBGUPNXSA-N.
| Molecular formula | C18H25NO |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | 4-methoxy-17-(trideuteriomethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| InChIKey | MKXZASYAUGDDCJ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCC23CCCCC2C1CC4=C3C=C(C=C4)OC |
Computed by PubChem (NCBI)