Di-sec-butyl succinate, 95%, 95%
cas: 626-31-3 — see every product listed under this CAS number, including other names
Di-sec-butyl succinate, 95%, 95% (CAS 626-31-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EQYQ-1g |
| cas | 626-31-3 |
| size | 1g |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 477.20 Pln | |
| Chemat | 25g | 750.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Dibutan-2-yl butanedioate (CAS 626-31-3) is a chemical compound with the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. IUPAC name: dibutan-2-yl butanedioate. InChIKey: PJZURRKQOJYGAU-UHFFFAOYSA-N.
| Molecular formula | C12H22O4 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | dibutan-2-yl butanedioate |
| InChIKey | PJZURRKQOJYGAU-UHFFFAOYSA-N |
| SMILES | CCC(C)OC(=O)CCC(=O)OC(C)CC |
Computed by PubChem (NCBI)
Synonyms:
Di-sec-butyl succinate, dibutan-2-yl butanedioate, Butanedioic acid bis(1-methylpropyl) ester, Butanedioic acid, bis(1-methylpropyl) ester, Succinic acid, di-sec-butyl ester, Succinic acid di-sec-butyl ester, 1,4-bis(butan-2-yl) butanedioate, di-s-butyl-succinate, Di-sec-butylsuccinate, disec-butyl butanedioate