Products 626-31-3
CAS 626-31-3 appears in our catalog under these names: Di-sec-butyl succinate, 95%, Di-sec-butyl succinate, 95%, 95%, DIBUTAN-2-YL BUTANEDIOATE. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 10g, 250mg.
Dibutan-2-yl butanedioate (CAS 626-31-3) is a chemical compound with the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. IUPAC name: dibutan-2-yl butanedioate. InChIKey: PJZURRKQOJYGAU-UHFFFAOYSA-N.
| Molecular formula | C12H22O4 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | dibutan-2-yl butanedioate |
| InChIKey | PJZURRKQOJYGAU-UHFFFAOYSA-N |
| SMILES | CCC(C)OC(=O)CCC(=O)OC(C)CC |
Computed by PubChem (NCBI)
Synonyms:
Di-sec-butyl succinate, dibutan-2-yl butanedioate, Butanedioic acid bis(1-methylpropyl) ester, Butanedioic acid, bis(1-methylpropyl) ester, Succinic acid, di-sec-butyl ester, Succinic acid di-sec-butyl ester, 1,4-bis(butan-2-yl) butanedioate, di-s-butyl-succinate, Di-sec-butylsuccinate, disec-butyl butanedioate