CAS 926-26-1 appears in our catalog under these names: Di-tert-butyl succinate, 95%, Di–tert–butyl succinate, Di-tert-butyl succinate 95%, Di-tert-butyl succinate, 95%, 95%, Di-tert-butyl succinate, 97.44%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 10g, 250mg, 25g, 100g, 100mg, 100 mg.
Ditert-butyl butanedioate (CAS 926-26-1) is a chemical compound with the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. IUPAC name: ditert-butyl butanedioate. InChIKey: GOORECODRBZTKF-UHFFFAOYSA-N.
| Molecular formula | C12H22O4 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | ditert-butyl butanedioate |
| InChIKey | GOORECODRBZTKF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)