CAS 638128-19-5 appears in our catalog under these names: Di–tert–butyl 4–chloropyridine–2,6–dicarboxylate, Di-tert-butyl 4-chloropyridine-2,6-dicarboxylate, 97%(LC-MS),RG, 97%(LC-MS),RG, Di-tert-butyl 4-chloropyridine-2,6-dicarboxylate, 97%(LC-MS),RG. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
Ditert-butyl 4-chloropyridine-2,6-dicarboxylate (CAS 638128-19-5) is a chemical compound with the molecular formula C15H20ClNO4 and a molecular weight of 313.77 g/mol. IUPAC name: ditert-butyl 4-chloropyridine-2,6-dicarboxylate. InChIKey: UYWBESJGMBTLJH-UHFFFAOYSA-N.
| Molecular formula | C15H20ClNO4 |
|---|---|
| Molecular weight | 313.77 g/mol |
| IUPAC name | ditert-butyl 4-chloropyridine-2,6-dicarboxylate |
| InChIKey | UYWBESJGMBTLJH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=CC(=N1)C(=O)OC(C)(C)C)Cl |
Computed by PubChem (NCBI)