CAS 1051916-41-6 is the registry number for Chloromethyl (2r)-2-([(tert-butoxy)carbonyl]amino)-3-phenylpropanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Chloromethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate (CAS 1051916-41-6) is a chemical compound with the molecular formula C15H20ClNO4 and a molecular weight of 313.77 g/mol. IUPAC name: chloromethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate. InChIKey: ZDVSSXVVRYYLKC-GFCCVEGCSA-N.
| Molecular formula | C15H20ClNO4 |
|---|---|
| Molecular weight | 313.77 g/mol |
| IUPAC name | chloromethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
| InChIKey | ZDVSSXVVRYYLKC-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=CC=C1)C(=O)OCCl |
Computed by PubChem (NCBI)