CAS 218608-95-8 appears in our catalog under these names: Boc-(s)-3-amino-4-(2-chloro-phenyl)-butyric acid, 95%, Boc–2–chloro–L–beta–homophenylalanine, (S)-3-((tert-Butoxycarbonyl)amino)-4-(2-chlorophenyl)butanoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
(3S)-4-(2-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 218608-95-8) is a chemical compound with the molecular formula C15H20ClNO4 and a molecular weight of 313.77 g/mol. IUPAC name: (3S)-4-(2-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: UBRPCCFLMVZEKN-NSHDSACASA-N.
| Molecular formula | C15H20ClNO4 |
|---|---|
| Molecular weight | 313.77 g/mol |
| IUPAC name | (3S)-4-(2-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | UBRPCCFLMVZEKN-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1Cl)CC(=O)O |
Computed by PubChem (NCBI)