cas: 926-26-1 — see every product listed under this CAS number, including other names
Di-tert-butyl succinate, 95%, 95% (CAS 926-26-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12H4OW-100mg |
| cas | 926-26-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 400.40 Pln | |
| Chemat | 5g | 1154.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ditert-butyl butanedioate (CAS 926-26-1) is a chemical compound with the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. IUPAC name: ditert-butyl butanedioate. InChIKey: GOORECODRBZTKF-UHFFFAOYSA-N.
| Molecular formula | C12H22O4 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | ditert-butyl butanedioate |
| InChIKey | GOORECODRBZTKF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)