cas: 10465-82-4 — see every product listed under this CAS number, including other names
Diazene-1,2-diylbis(morpholinomethanone) 97% (CAS 10465-82-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A965599-1g |
| cas | 10465-82-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 720.81 Pln | |
| Ambeed | 25g | 2161.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A965599 |
(NE)-N-(morpholine-4-carbonylimino)morpholine-4-carboxamide (CAS 10465-82-4) is a chemical compound with the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. IUPAC name: (NE)-N-(morpholine-4-carbonylimino)morpholine-4-carboxamide. InChIKey: CHAMTJKQPOMXTI-VAWYXSNFSA-N.
| Molecular formula | C10H16N4O4 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | (NE)-N-(morpholine-4-carbonylimino)morpholine-4-carboxamide |
| InChIKey | CHAMTJKQPOMXTI-VAWYXSNFSA-N |
| SMILES | C1COCCN1C(=O)/N=N/C(=O)N2CCOCC2 |
Computed by PubChem (NCBI)