cas: 55-43-6 — see every product listed under this CAS number, including other names
Dibenamine HCl 96% (CAS 55-43-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A412716-25g |
| cas | 55-43-6 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 971.12 Pln | |
| Ambeed | 100g | 3212.81 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A412716 |
N,N-dibenzyl-2-chloroethanamine;hydrochloride (CAS 55-43-6) is a chemical compound with the molecular formula C16H19Cl2N and a molecular weight of 296.2 g/mol. IUPAC name: N,N-dibenzyl-2-chloroethanamine;hydrochloride. InChIKey: LZXCEBPGNFLHEQ-UHFFFAOYSA-N.
| Molecular formula | C16H19Cl2N |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | N,N-dibenzyl-2-chloroethanamine;hydrochloride |
| InChIKey | LZXCEBPGNFLHEQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(CCCl)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)