CAS 55-43-6 appears in our catalog under these names: N-(2-Chloroethyl)dibenzylamine hydrochloride, 98%, Dibenamine Hydrochloride, Dibenamine hydrochloride/ 96.43% (existing batch purity), Dibenamine hydrochloride, N-(2-Chloroethyl)dibenzylamine Hydrochloride, >98.0%(N). Offered by: Combi-blocks, LoGiCal, TargetMol, GLPBio, TCI. Available pack sizes: 25g, 500g, 100g, 5g, 1g, 10mg, 500mg, 10mM (in 1ml dmso).
N,N-dibenzyl-2-chloroethanamine;hydrochloride (CAS 55-43-6) is a chemical compound with the molecular formula C16H19Cl2N and a molecular weight of 296.2 g/mol. IUPAC name: N,N-dibenzyl-2-chloroethanamine;hydrochloride. InChIKey: LZXCEBPGNFLHEQ-UHFFFAOYSA-N.
| Molecular formula | C16H19Cl2N |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | N,N-dibenzyl-2-chloroethanamine;hydrochloride |
| InChIKey | LZXCEBPGNFLHEQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(CCCl)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)