Dibenamine (hydrochloride), 99.32%
cas: 55-43-6 — see every product listed under this CAS number, including other names
Dibenamine (hydrochloride), 99.32% (CAS 55-43-6) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 5 g, 10mM/1mL. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-128380-1 g |
| cas | 55-43-6 |
| size | 1 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 263.96 Pln | |
| MedChemExpress | 5 g | 575.11 Pln | |
| MedChemExpress | 10mM/1mL | 277.90 Pln |
properties
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.32% |
N,N-dibenzyl-2-chloroethanamine;hydrochloride (CAS 55-43-6) is a chemical compound with the molecular formula C16H19Cl2N and a molecular weight of 296.2 g/mol. IUPAC name: N,N-dibenzyl-2-chloroethanamine;hydrochloride. InChIKey: LZXCEBPGNFLHEQ-UHFFFAOYSA-N.
| Molecular formula | C16H19Cl2N |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | N,N-dibenzyl-2-chloroethanamine;hydrochloride |
| InChIKey | LZXCEBPGNFLHEQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(CCCl)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)
Synonyms:
Dibenamine hydrochloride, N-(2-Chloroethyl)dibenzylamine hydrochloride, Dibenzylchlorethamine hydrochloride, N,N-Dibenzyl-2-chloroethylamine hydrochloride, Dibenamine HCl, N,N-Dibenzylaminoethyl chloride hydrochloride, Dibenzylchlorethylamine hydrochloride, 2-Chloroethyldibenzylamine hydrochloride, Dibenzyl(2-chloroethyl)ammonium chloride, 2-Dibenzylaminoethyl chloride hydrochloride