Dibenzenesulfonimide, 98%
cas: 2618-96-4 — see every product listed under this CAS number, including other names
Dibenzenesulfonimide, 98% (CAS 2618-96-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A177779-5g |
| cas | 2618-96-4 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 25g | 131.19 Pln | |
| Ambeed | 100g | 181.25 Pln | |
| Ambeed | 500g | 420.44 Pln | |
| Ambeed | 1kg | 654.06 Pln | |
| BLDpharm | 5g | 125.54 Pln | |
| BLDpharm | 25g | 192.18 Pln | |
| BLDpharm | 100g | 219.95 Pln | |
| BLDpharm | 500g | 319.91 Pln | |
| BLDpharm | 1kg | 564.27 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
N-(benzenesulfonyl)benzenesulfonamide (CAS 2618-96-4) is a chemical compound with the molecular formula C12H11NO4S2 and a molecular weight of 297.4 g/mol. IUPAC name: N-(benzenesulfonyl)benzenesulfonamide. InChIKey: OVQABVAKPIYHIG-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4S2 |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | N-(benzenesulfonyl)benzenesulfonamide |
| InChIKey | OVQABVAKPIYHIG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NS(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)