Products 886732-79-2

CAS 886732-79-2 is the registry number for 3-((Thiophene-2-sulfonamido)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-[(thiophen-2-ylsulfonylamino)methyl]benzoic acid (CAS 886732-79-2) is a chemical compound with the molecular formula C12H11NO4S2 and a molecular weight of 297.4 g/mol. IUPAC name: 3-[(thiophen-2-ylsulfonylamino)methyl]benzoic acid. InChIKey: GSOAHZXDQFVNCJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11NO4S2
Molecular weight297.4 g/mol
IUPAC name3-[(thiophen-2-ylsulfonylamino)methyl]benzoic acid
InChIKeyGSOAHZXDQFVNCJ-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(=O)O)CNS(=O)(=O)C2=CC=CS2

Computed by PubChem (NCBI)