Products 2618-96-4
CAS 2618-96-4 appears in our catalog under these names: Dibenzenesulfonamide, Dibenzenesulfonamide, 95% , Dibenzenesulfonimide, Dibenzenesulfonimide, >98.0%(HPLC), Dibenzenesulfonimide 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 100g, 500g, 250mg, 25g, 10g, 5g, 50g, 250g.
N-(benzenesulfonyl)benzenesulfonamide (CAS 2618-96-4) is a chemical compound with the molecular formula C12H11NO4S2 and a molecular weight of 297.4 g/mol. IUPAC name: N-(benzenesulfonyl)benzenesulfonamide. InChIKey: OVQABVAKPIYHIG-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4S2 |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | N-(benzenesulfonyl)benzenesulfonamide |
| InChIKey | OVQABVAKPIYHIG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NS(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)