Dibenzo[b,d]thiophene-3,7-diamine, 97%
cas: 41738-64-1 — see every product listed under this CAS number, including other names
Dibenzo[b,d]thiophene-3,7-diamine, 97% (CAS 41738-64-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A307053-250mg |
| cas | 41738-64-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 559.50 Pln | |
| Ambeed | 5g | 1705.38 Pln | |
| BLDpharm | 250mg | 269.93 Pln | |
| BLDpharm | 1g | 603.15 Pln | |
| BLDpharm | 5g | 1830.49 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 486.80 Pln | |
| Chemat | 5g | 1557.20 Pln | |
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 1g | 575.86 Pln | |
| Fluorochem | 5g | 1747.32 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Dibenzothiophene-3,7-diamine (CAS 41738-64-1) is a chemical compound with the molecular formula C12H10N2S and a molecular weight of 214.29 g/mol. IUPAC name: dibenzothiophene-3,7-diamine. InChIKey: YFQKVQDMYAXRRC-UHFFFAOYSA-N.
| Molecular formula | C12H10N2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | dibenzothiophene-3,7-diamine |
| InChIKey | YFQKVQDMYAXRRC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)SC3=C2C=CC(=C3)N |
Computed by PubChem (NCBI)