Products 91974-48-0
CAS 91974-48-0 is the registry number for Cinnamylidencyanothioacetamide, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2E,4E)-2-cyano-5-phenylpenta-2,4-dienethioamide (CAS 91974-48-0) is a chemical compound with the molecular formula C12H10N2S and a molecular weight of 214.29 g/mol. IUPAC name: (2E,4E)-2-cyano-5-phenylpenta-2,4-dienethioamide. InChIKey: ZFQNTRNDIHSZDF-VCABWLAWSA-N.
| Molecular formula | C12H10N2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | (2E,4E)-2-cyano-5-phenylpenta-2,4-dienethioamide |
| InChIKey | ZFQNTRNDIHSZDF-VCABWLAWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C=C(\C#N)/C(=S)N |
Computed by PubChem (NCBI)