CAS 364596-21-4 appears in our catalog under these names: 2-Amino-5-benzylthiophene-3-carbonitrile, 95%, 2-Amino-5-benzylthiophene-3-carbonitrile, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 250mg, 100mg.
2-amino-5-benzylthiophene-3-carbonitrile (CAS 364596-21-4) is a chemical compound with the molecular formula C12H10N2S and a molecular weight of 214.29 g/mol. IUPAC name: 2-amino-5-benzylthiophene-3-carbonitrile. InChIKey: JDJHEJKTLUMKAE-UHFFFAOYSA-N.
| Molecular formula | C12H10N2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | 2-amino-5-benzylthiophene-3-carbonitrile |
| InChIKey | JDJHEJKTLUMKAE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=C(S2)N)C#N |
Computed by PubChem (NCBI)