cas: 3158-85-8 — see every product listed under this CAS number, including other names
Dibenzo[b,f][1,4]oxazepin-11(10H)-one 95% (CAS 3158-85-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A123189-100mg |
| cas | 3158-85-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 275.81 Pln | |
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 398.19 Pln | |
| Ambeed | 5g | 1110.19 Pln | |
| Ambeed | 10g | 1894.50 Pln | |
| Ambeed | 25g | 3713.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A123189 |
5H-benzo[b][1,4]benzoxazepin-6-one (CAS 3158-85-8) is a chemical compound with the molecular formula C13H9NO2 and a molecular weight of 211.22 g/mol. IUPAC name: 5H-benzo[b][1,4]benzoxazepin-6-one. InChIKey: OXMPDOZBQGHTGH-UHFFFAOYSA-N.
| Molecular formula | C13H9NO2 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 5H-benzo[b][1,4]benzoxazepin-6-one |
| InChIKey | OXMPDOZBQGHTGH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC3=CC=CC=C3O2 |
Computed by PubChem (NCBI)