Products 7600-50-2

CAS 7600-50-2 appears in our catalog under these names: Dicamba-5-hydroxy, Dicamba-5-hydroxy 100 µg/mL in Acetonitrile, 2,5-Dichloro-3-hydroxy-6-methoxybenzoic acid. Offered by: Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: 25mg, 1ml, 10mg, 50mg, 250mg, 100mg, 1x25mg.

Structural formula: {0} (CAS {1})

2,5-dichloro-3-hydroxy-6-methoxybenzoic acid (CAS 7600-50-2) is a chemical compound with the molecular formula C8H6Cl2O4 and a molecular weight of 237.03 g/mol. IUPAC name: 2,5-dichloro-3-hydroxy-6-methoxybenzoic acid. InChIKey: XYHBJALHMANCCC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6Cl2O4
Molecular weight237.03 g/mol
IUPAC name2,5-dichloro-3-hydroxy-6-methoxybenzoic acid
InChIKeyXYHBJALHMANCCC-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1C(=O)O)Cl)O)Cl

Computed by PubChem (NCBI)