cas: 1369427-40-6 — see every product listed under this CAS number, including other names
Dicyclohexylamine (2R,3R)-3-((S)-1-(tert-butoxycarbonyl)pyrrolidin-2-yl)-3-methoxy-2-methylpropanoate, 98% (CAS 1369427-40-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g, 50g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F988961-100MG |
| cas | 1369427-40-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 940.31 Pln | |
| Fluorochem | 250mg | 1080.89 Pln | |
| Fluorochem | 500mg | 1887.89 Pln | |
| Fluorochem | 1g | 2580.36 Pln | |
| Fluorochem | 5g | 8901.05 Pln | |
| Fluorochem | 25g | 12431.06 Pln | |
| Fluorochem | 50g | 18491.42 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
N-cyclohexylcyclohexanamine;(2R,3R)-3-methoxy-2-methyl-3-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]propanoic acid (CAS 1369427-40-6) is a chemical compound with the molecular formula C26H48N2O5 and a molecular weight of 468.7 g/mol. IUPAC name: N-cyclohexylcyclohexanamine;(2R,3R)-3-methoxy-2-methyl-3-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]propanoic acid. InChIKey: PKZALTWOMMNNOL-QJQMQQLTSA-N.
| Molecular formula | C26H48N2O5 |
|---|---|
| Molecular weight | 468.7 g/mol |
| IUPAC name | N-cyclohexylcyclohexanamine;(2R,3R)-3-methoxy-2-methyl-3-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]propanoic acid |
| InChIKey | PKZALTWOMMNNOL-QJQMQQLTSA-N |
| SMILES | C[C@H]([C@H]([C@@H]1CCCN1C(=O)OC(C)(C)C)OC)C(=O)O.C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)