N–Boc–dolaproine dicyclohexylamine
cas: 1369427-40-6 — see every product listed under this CAS number, including other names
N–Boc–dolaproine dicyclohexylamine (CAS 1369427-40-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 5g, 500mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC75906-1 |
| cas | 1369427-40-6 |
| size | 1g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 611.08 Pln | |
| GLPBio | 10g | 1678.24 Pln | |
| GLPBio | 25g | 2941.97 Pln | |
| GLPBio | 5g | 1172.74 Pln | |
| GLPBio | 500mg | 554.92 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
N-cyclohexylcyclohexanamine;(2R,3R)-3-methoxy-2-methyl-3-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]propanoic acid (CAS 1369427-40-6) is a chemical compound with the molecular formula C26H48N2O5 and a molecular weight of 468.7 g/mol. IUPAC name: N-cyclohexylcyclohexanamine;(2R,3R)-3-methoxy-2-methyl-3-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]propanoic acid. InChIKey: PKZALTWOMMNNOL-QJQMQQLTSA-N.
| Molecular formula | C26H48N2O5 |
|---|---|
| Molecular weight | 468.7 g/mol |
| IUPAC name | N-cyclohexylcyclohexanamine;(2R,3R)-3-methoxy-2-methyl-3-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]propanoic acid |
| InChIKey | PKZALTWOMMNNOL-QJQMQQLTSA-N |
| SMILES | C[C@H]([C@H]([C@@H]1CCCN1C(=O)OC(C)(C)C)OC)C(=O)O.C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)