N-Boc-dolaproine (dicyclohexylamine), 99.95%
cas: 1369427-40-6 — see every product listed under this CAS number, including other names
N-Boc-dolaproine (dicyclohexylamine), 99.95% (CAS 1369427-40-6) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 100 mg, 250 mg, 500 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-33046A-1 g |
| cas | 1369427-40-6 |
| size | 1 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 672.64 Pln | |
| MedChemExpress | 100 mg | 263.96 Pln | |
| MedChemExpress | 250 mg | 333.62 Pln | |
| MedChemExpress | 500 mg | 463.66 Pln |
properties
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.95% |
N-cyclohexylcyclohexanamine;(2R,3R)-3-methoxy-2-methyl-3-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]propanoic acid (CAS 1369427-40-6) is a chemical compound with the molecular formula C26H48N2O5 and a molecular weight of 468.7 g/mol. IUPAC name: N-cyclohexylcyclohexanamine;(2R,3R)-3-methoxy-2-methyl-3-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]propanoic acid. InChIKey: PKZALTWOMMNNOL-QJQMQQLTSA-N.
| Molecular formula | C26H48N2O5 |
|---|---|
| Molecular weight | 468.7 g/mol |
| IUPAC name | N-cyclohexylcyclohexanamine;(2R,3R)-3-methoxy-2-methyl-3-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]propanoic acid |
| InChIKey | PKZALTWOMMNNOL-QJQMQQLTSA-N |
| SMILES | C[C@H]([C@H]([C@@H]1CCCN1C(=O)OC(C)(C)C)OC)C(=O)O.C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)