Dicyclohexylamine 2-cyanoacrylate, 95%
cas: 263703-32-8 — see every product listed under this CAS number, including other names
Dicyclohexylamine 2-cyanoacrylate, 95% (CAS 263703-32-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A731939-250mg |
| cas | 263703-32-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 782.00 Pln | |
| Ambeed | 5g | 2450.75 Pln | |
| BLDpharm | 100mg | 336.57 Pln | |
| BLDpharm | 250mg | 414.32 Pln | |
| BLDpharm | 1g | 841.95 Pln | |
| BLDpharm | 5g | 2635.76 Pln | |
| Fluorochem | 100mg | 310.32 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 768.50 Pln | |
| Fluorochem | 5g | 2398.13 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-cyanoprop-2-enoic acid;N-cyclohexylcyclohexanamine (CAS 263703-32-8) is a chemical compound with the molecular formula C16H26N2O2 and a molecular weight of 278.39 g/mol. IUPAC name: 2-cyanoprop-2-enoic acid;N-cyclohexylcyclohexanamine. InChIKey: KBUNPAIJSVOOSU-UHFFFAOYSA-N.
| Molecular formula | C16H26N2O2 |
|---|---|
| Molecular weight | 278.39 g/mol |
| IUPAC name | 2-cyanoprop-2-enoic acid;N-cyclohexylcyclohexanamine |
| InChIKey | KBUNPAIJSVOOSU-UHFFFAOYSA-N |
| SMILES | C=C(C#N)C(=O)O.C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)