CAS 14931-70-5 appears in our catalog under these names: N,N'-(5,7-dimethyl adamantane-1,3-diyl) diacetamide, 5,7-Diacetamido-1,3-dimethyladamantane. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5g.
N-(3-acetamido-5,7-dimethyl-1-adamantyl)acetamide (CAS 14931-70-5) is a chemical compound with the molecular formula C16H26N2O2 and a molecular weight of 278.39 g/mol. IUPAC name: N-(3-acetamido-5,7-dimethyl-1-adamantyl)acetamide. InChIKey: MSQGNHPUFDAVHW-UHFFFAOYSA-N.
| Molecular formula | C16H26N2O2 |
|---|---|
| Molecular weight | 278.39 g/mol |
| IUPAC name | N-(3-acetamido-5,7-dimethyl-1-adamantyl)acetamide |
| InChIKey | MSQGNHPUFDAVHW-UHFFFAOYSA-N |
| SMILES | CC(=O)NC12CC3(CC(C1)(CC(C3)(C2)NC(=O)C)C)C |
Computed by PubChem (NCBI)