cas: 86724-13-2 — see every product listed under this CAS number, including other names
Diethyl 1H-imidazole-2,4-dicarboxylate, 95%, 95% (CAS 86724-13-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115K9X-1g |
| cas | 86724-13-2 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2541.20 Pln | |
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1302.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Diethyl 1H-imidazole-2,5-dicarboxylate (CAS 86724-13-2) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: diethyl 1H-imidazole-2,5-dicarboxylate. InChIKey: GATNVKATWLZAGO-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | diethyl 1H-imidazole-2,5-dicarboxylate |
| InChIKey | GATNVKATWLZAGO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(N1)C(=O)OCC |
Computed by PubChem (NCBI)