Products 6937-25-3

CAS 6937-25-3 is the registry number for Diethyl 2,2'-oxydipropionate, 98%. Offered by: Ambeed. Available pack sizes: 250mg, 50mg, 100mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(1-ethoxy-1-oxopropan-2-yl)oxypropanoate (CAS 6937-25-3) is a chemical compound with the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. IUPAC name: ethyl 2-(1-ethoxy-1-oxopropan-2-yl)oxypropanoate. InChIKey: RPDMOJMOEXTZSV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18O5
Molecular weight218.25 g/mol
IUPAC nameethyl 2-(1-ethoxy-1-oxopropan-2-yl)oxypropanoate
InChIKeyRPDMOJMOEXTZSV-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)OC(C)C(=O)OCC

Computed by PubChem (NCBI)