Products 1879943-11-9
CAS 1879943-11-9 appears in our catalog under these names: 1,1′-Diethyl (2R,2′S)-2,2′-oxybis[propanoate], 98%, 1,1′-Diethyl (2R,2′S)-2,2′-oxybis[propanoate], 98%, 98%, 1,1′-Diethyl (2R,2′S)-2,2′-oxybis[propanoate], 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
Ethyl (2R)-2-[(2S)-1-ethoxy-1-oxopropan-2-yl]oxypropanoate (CAS 1879943-11-9) is a chemical compound with the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. IUPAC name: ethyl (2R)-2-[(2S)-1-ethoxy-1-oxopropan-2-yl]oxypropanoate. InChIKey: RPDMOJMOEXTZSV-OCAPTIKFSA-N.
| Molecular formula | C10H18O5 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | ethyl (2R)-2-[(2S)-1-ethoxy-1-oxopropan-2-yl]oxypropanoate |
| InChIKey | RPDMOJMOEXTZSV-OCAPTIKFSA-N |
| SMILES | CCOC(=O)[C@@H](C)O[C@@H](C)C(=O)OCC |
Computed by PubChem (NCBI)