cas: 65076-02-0 — see every product listed under this CAS number, including other names
Diethyl 2-((thiophen-3-ylamino)methylene)malonate, 95% (CAS 65076-02-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F752765-100MG |
| cas | 65076-02-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 653.95 Pln | |
| Fluorochem | 1g | 1606.74 Pln | |
| Fluorochem | 5g | 3913.22 Pln | |
| Fluorochem | 10g | 5850.04 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Diethyl 2-[(thiophen-3-ylamino)methylidene]propanedioate (CAS 65076-02-0) is a chemical compound with the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. IUPAC name: diethyl 2-[(thiophen-3-ylamino)methylidene]propanedioate. InChIKey: MVTXURCRYVWETP-UHFFFAOYSA-N.
| Molecular formula | C12H15NO4S |
|---|---|
| Molecular weight | 269.32 g/mol |
| IUPAC name | diethyl 2-[(thiophen-3-ylamino)methylidene]propanedioate |
| InChIKey | MVTXURCRYVWETP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=CNC1=CSC=C1)C(=O)OCC |
Computed by PubChem (NCBI)