CAS 128899-31-0 is the registry number for (R)-(5-Oxopyrrolidin-2-yl)methyl 4-methylbenzenesulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[(2R)-5-oxopyrrolidin-2-yl]methyl 4-methylbenzenesulfonate (CAS 128899-31-0) is a chemical compound with the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. IUPAC name: [(2R)-5-oxopyrrolidin-2-yl]methyl 4-methylbenzenesulfonate. InChIKey: AMZNHHZJURKRFX-SNVBAGLBSA-N.
| Molecular formula | C12H15NO4S |
|---|---|
| Molecular weight | 269.32 g/mol |
| IUPAC name | [(2R)-5-oxopyrrolidin-2-yl]methyl 4-methylbenzenesulfonate |
| InChIKey | AMZNHHZJURKRFX-SNVBAGLBSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@H]2CCC(=O)N2 |
Computed by PubChem (NCBI)